C29H37NO8 — CID 57350105
3-[3-(3,4-dimethoxyphenyl)propylamino]-2-methyl-1,1-diphenylpropan-1-ol;oxalic acid;hydrate (PubChem CID 57350105) has the molecular formula C29H37NO8 and a molecular weight of 527.61 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)propylamino]-2-methyl-1,1-diphenylpropan-1-ol;oxalic acid;hydrate.
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)propylamino]-2-methyl-1,1-diphenylpropan-1-ol;oxalic acid;hydrate |
|---|---|
| PubChem CID | 57350105 |
| Molecular Formula | C29H37NO8 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)propylamino]-2-methyl-1,1-diphenylpropan-1-ol;oxalic acid;hydrate |
| SMILES | COc1ccc(CCCNCC(C)C(O)(c2ccccc2)c2ccccc2)cc1OC.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H33NO3.C2H2O4.H2O/c1-21(20-28-18-10-11-22-16-17-25(30-2)26(19-22)31-3)27(29,23-12-6-4-7-13-23)24-14-8-5-9-15-24;3-1(4)2(5)6;/h4-9,12-17,19,21,28-29H,10-11,18,20H2,1-3H3;(H,3,4)(H,5,6);1H2 |
| InChIKey | AYENWZBPMKJLOA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|