C19H25NO7S — CID 21434721
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-2-thiophen-2-ylethanamine;oxalic acid (PubChem CID 21434721) has the molecular formula C19H25NO7S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-2-thiophen-2-ylethanamine;oxalic acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-2-thiophen-2-ylethanamine;oxalic acid |
|---|---|
| PubChem CID | 21434721 |
| Molecular Formula | C19H25NO7S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxy-2-thiophen-2-ylethanamine;oxalic acid |
| SMILES | COc1ccc(CCNCC(OC)c2cccs2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H23NO3S.C2H2O4/c1-19-14-7-6-13(11-15(14)20-2)8-9-18-12-16(21-3)17-5-4-10-22-17;3-1(4)2(5)6/h4-7,10-11,16,18H,8-9,12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | HWVMFIYOZQYPIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|