C19H33NO5 — CID 70447049
tert-butyl 2-(3-ethoxycarbonyl-5-methylhexanoyl)pyrrolidine-1-carboxylate (PubChem CID 70447049) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl 2-(3-ethoxycarbonyl-5-methylhexanoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-ethoxycarbonyl-5-methylhexanoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70447049 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | tert-butyl 2-(3-ethoxycarbonyl-5-methylhexanoyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C(CC(=O)C1CCCN1C(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C19H33NO5/c1-7-24-17(22)14(11-13(2)3)12-16(21)15-9-8-10-20(15)18(23)25-19(4,5)6/h13-15H,7-12H2,1-6H3 |
| InChIKey | SKDJRGIAAMPBPR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |