C13H16BrF3OS — CID 70447172
2-(4-bromobutoxy)-1-methyl-4-(2,2,2-trifluoroethylsulfanyl)benzene (PubChem CID 70447172) has the molecular formula C13H16BrF3OS and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-(4-bromobutoxy)-1-methyl-4-(2,2,2-trifluoroethylsulfanyl)benzene.
| Compound Name | 2-(4-bromobutoxy)-1-methyl-4-(2,2,2-trifluoroethylsulfanyl)benzene |
|---|---|
| PubChem CID | 70447172 |
| Molecular Formula | C13H16BrF3OS |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-(4-bromobutoxy)-1-methyl-4-(2,2,2-trifluoroethylsulfanyl)benzene |
| SMILES | Cc1ccc(SCC(F)(F)F)cc1OCCCCBr |
| InChI | InChI=1S/C13H16BrF3OS/c1-10-4-5-11(19-9-13(15,16)17)8-12(10)18-7-3-2-6-14/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | SAVBRYUUCOJQJM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|