C17H20FNOS — CID 79130161
4-[3-(2,5-dimethylphenoxy)propylsulfanyl]-2-fluoroaniline (PubChem CID 79130161) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[3-(2,5-dimethylphenoxy)propylsulfanyl]-2-fluoroaniline.
| Compound Name | 4-[3-(2,5-dimethylphenoxy)propylsulfanyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 79130161 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[3-(2,5-dimethylphenoxy)propylsulfanyl]-2-fluoroaniline |
| SMILES | Cc1ccc(C)c(OCCCSc2ccc(N)c(F)c2)c1 |
| InChI | InChI=1S/C17H20FNOS/c1-12-4-5-13(2)17(10-12)20-8-3-9-21-14-6-7-16(19)15(18)11-14/h4-7,10-11H,3,8-9,19H2,1-2H3 |
| InChIKey | PVJVHFHUFHOPHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|