C12H18FNS — CID 79140918
4-(3,3-dimethylbutylsulfanyl)-2-fluoroaniline (PubChem CID 79140918) has the molecular formula C12H18FNS and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-(3,3-dimethylbutylsulfanyl)-2-fluoroaniline.
| Compound Name | 4-(3,3-dimethylbutylsulfanyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 79140918 |
| Molecular Formula | C12H18FNS |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(3,3-dimethylbutylsulfanyl)-2-fluoroaniline |
| SMILES | CC(C)(C)CCSc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C12H18FNS/c1-12(2,3)6-7-15-9-4-5-11(14)10(13)8-9/h4-5,8H,6-7,14H2,1-3H3 |
| InChIKey | GUPHCLOMNZVVKE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|