C23H32N2O5S — CID 70451540
5-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,6,7,7a-hexahydro-1H-thieno[3,4-c]pyridine-4-carboxylic acid (PubChem CID 70451540) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 5-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,6,7,7a-hexahydro-1H-thieno[3,4-c]pyridine-4-carboxylic acid.
| Compound Name | 5-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,6,7,7a-hexahydro-1H-thieno[3,4-c]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 70451540 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 5-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,6,7,7a-hexahydro-1H-thieno[3,4-c]pyridine-4-carboxylic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)N[C@@H](C)C(=O)N1CCC2CSCC2C1C(=O)O |
| InChI | InChI=1S/C23H32N2O5S/c1-3-30-23(29)19(10-9-16-7-5-4-6-8-16)24-15(2)21(26)25-12-11-17-13-31-14-18(17)20(25)22(27)28/h4-8,15,17-20,24H,3,9-14H2,1-2H3,(H,27,28)/t15-,17?,18?,19?,20?/m0/s1 |
| InChIKey | GMPSZBNDJUEVMO-KEDVPNTESA-N |
| XLogP | 2.19 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |