C26H32N2O4S — CID 70451852
4-[(3S)-3-[bis[(2S)-2-hydroxy-2-phenylethyl]amino]butyl]benzenesulfonamide (PubChem CID 70451852) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is 4-[(3S)-3-[bis[(2S)-2-hydroxy-2-phenylethyl]amino]butyl]benzenesulfonamide.
| Compound Name | 4-[(3S)-3-[bis[(2S)-2-hydroxy-2-phenylethyl]amino]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70451852 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[(3S)-3-[bis[(2S)-2-hydroxy-2-phenylethyl]amino]butyl]benzenesulfonamide |
| SMILES | C[C@@H](CCc1ccc(S(N)(=O)=O)cc1)N(C[C@@H](O)c1ccccc1)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O4S/c1-20(12-13-21-14-16-24(17-15-21)33(27,31)32)28(18-25(29)22-8-4-2-5-9-22)19-26(30)23-10-6-3-7-11-23/h2-11,14-17,20,25-26,29-30H,12-13,18-19H2,1H3,(H2,27,31,32)/t20-,25+,26+/m0/s1 |
| InChIKey | GNAIMLNXWOHXRA-GKBBYZSKSA-N |
| XLogP | 3.42 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |