C20H16N2O3 — CID 70452206
3-[6-(dimethylamino)-1-benzofuran-2-yl]-4-phenylpyrrole-2,5-dione (PubChem CID 70452206) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[6-(dimethylamino)-1-benzofuran-2-yl]-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-[6-(dimethylamino)-1-benzofuran-2-yl]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 70452206 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-[6-(dimethylamino)-1-benzofuran-2-yl]-4-phenylpyrrole-2,5-dione |
| SMILES | CN(C)c1ccc2cc(C3=C(c4ccccc4)C(=O)NC3=O)oc2c1 |
| InChI | InChI=1S/C20H16N2O3/c1-22(2)14-9-8-13-10-16(25-15(13)11-14)18-17(19(23)21-20(18)24)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,21,23,24) |
| InChIKey | LGHXJVYMYIAUQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|