C20H21N3O2 — CID 153326132
7-(dimethylamino)-3-(1,3-dimethyl-2H-benzimidazol-2-yl)chromen-2-one (PubChem CID 153326132) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 7-(dimethylamino)-3-(1,3-dimethyl-2H-benzimidazol-2-yl)chromen-2-one.
| Compound Name | 7-(dimethylamino)-3-(1,3-dimethyl-2H-benzimidazol-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 153326132 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 7-(dimethylamino)-3-(1,3-dimethyl-2H-benzimidazol-2-yl)chromen-2-one |
| SMILES | CN(C)c1ccc2cc(C3N(C)c4ccccc4N3C)c(=O)oc2c1 |
| InChI | InChI=1S/C20H21N3O2/c1-21(2)14-10-9-13-11-15(20(24)25-18(13)12-14)19-22(3)16-7-5-6-8-17(16)23(19)4/h5-12,19H,1-4H3 |
| InChIKey | PUYLARZGRJOKGZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|