C18H20BNO4 — CID 88942747
CID 88942747 (PubChem CID 88942747) has the molecular formula C18H20BNO4 and a molecular weight of 325.17 g/mol.
| Compound Name | CID 88942747 |
|---|---|
| PubChem CID | 88942747 |
| Molecular Formula | C18H20BNO4 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | — |
| SMILES | [B]C1CCC(OC(=O)c2cc3ccc(N(C)C)cc3oc2=O)CC1 |
| InChI | InChI=1S/C18H20BNO4/c1-20(2)13-6-3-11-9-15(18(22)24-16(11)10-13)17(21)23-14-7-4-12(19)5-8-14/h3,6,9-10,12,14H,4-5,7-8H2,1-2H3 |
| InChIKey | CEQHFCCBQXFNFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|