C21H34N3O+ — CID 7045283
8-butyl-6-(hexylamino)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-7-ium-5-carbonitrile (PubChem CID 7045283) has the molecular formula C21H34N3O+ and a molecular weight of 344.52 g/mol. Its IUPAC name is 8-butyl-6-(hexylamino)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-7-ium-5-carbonitrile.
| Compound Name | 8-butyl-6-(hexylamino)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-7-ium-5-carbonitrile |
|---|---|
| PubChem CID | 7045283 |
| Molecular Formula | C21H34N3O+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 8-butyl-6-(hexylamino)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-7-ium-5-carbonitrile |
| SMILES | CCCCCCNc1[nH+]c(CCCC)c2c(c1C#N)CC(C)(C)OC2 |
| InChI | InChI=1S/C21H33N3O/c1-5-7-9-10-12-23-20-17(14-22)16-13-21(3,4)25-15-18(16)19(24-20)11-8-6-2/h5-13,15H2,1-4H3,(H,23,24)/p+1 |
| InChIKey | OQLSQAXLSDHVOF-UHFFFAOYSA-O |
| XLogP | 4.56 |
| TPSA | 59.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|