About copper;N,N-dimethylpyridin-4-amine;propyl hypobromite
copper;N,N-dimethylpyridin-4-amine;propyl hypobromite (PubChem CID 70454587) has the molecular formula C10H17BrCuN2O
and a molecular weight of 324.71 g/mol. Its IUPAC name is copper;N,N-dimethylpyridin-4-amine;propyl hypobromite.
Molecular Properties
| Compound Name | copper;N,N-dimethylpyridin-4-amine;propyl hypobromite |
| PubChem CID | 70454587 |
| Molecular Formula | C10H17BrCuN2O |
| Molecular Weight | 324.71 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | copper;N,N-dimethylpyridin-4-amine;propyl hypobromite |
| SMILES | CCCOBr.CN(C)c1ccncc1.[Cu] |
| InChI | InChI=1S/C7H10N2.C3H7BrO.Cu/c1-9(2)7-3-5-8-6-4-7;1-2-3-5-4;/h3-6H,1-2H3;2-3H2,1H3; |
| InChIKey | DBQBASSRPAFCQH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze copper;N,N-dimethylpyridin-4-amine;propyl hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;N,N-dimethylpyridin-4-amine;propyl hypobromite?
The IUPAC name of copper;N,N-dimethylpyridin-4-amine;propyl hypobromite (CID 70454587) is copper;N,N-dimethylpyridin-4-amine;propyl hypobromite.
What is the SMILES notation for copper;N,N-dimethylpyridin-4-amine;propyl hypobromite?
The canonical SMILES for copper;N,N-dimethylpyridin-4-amine;propyl hypobromite is CCCOBr.CN(C)c1ccncc1.[Cu].
What is the InChIKey of copper;N,N-dimethylpyridin-4-amine;propyl hypobromite?
The InChIKey is DBQBASSRPAFCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C3H7BrO.Cu/c1-9(2)7-3-5-8-6-4-7;1-2-3-5-4;/h3-6H,1-2H3;2-3H2,1H3;.
What are the key properties of copper;N,N-dimethylpyridin-4-amine;propyl hypobromite?
copper;N,N-dimethylpyridin-4-amine;propyl hypobromite has a molecular weight of 324.71 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;N,N-dimethylpyridin-4-amine;propyl hypobromite is sourced from PubChem (CID 70454587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).