C6H9N5O2 — CID 70456697
1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-5-yl)urea (PubChem CID 70456697) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-5-yl)urea.
| Compound Name | 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 70456697 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-5-yl)urea |
| SMILES | C/N=C(\N)NC(=O)Nc1cnco1 |
| InChI | InChI=1S/C6H9N5O2/c1-8-5(7)11-6(12)10-4-2-9-3-13-4/h2-3H,1H3,(H4,7,8,10,11,12) |
| InChIKey | IVXHXHXBGXNHSO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|