C6H12N4S — CID 70458123
N'-[(4-methylthiadiazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 70458123) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is N'-[(4-methylthiadiazol-5-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(4-methylthiadiazol-5-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 70458123 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N'-[(4-methylthiadiazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | Cc1nnsc1CNCCN |
| InChI | InChI=1S/C6H12N4S/c1-5-6(11-10-9-5)4-8-3-2-7/h8H,2-4,7H2,1H3 |
| InChIKey | FKHZCXVTZZUGOW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|