C12H21N3O — CID 70459249
2,3,4-tris(methylaminomethyl)phenol (PubChem CID 70459249) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,3,4-tris(methylaminomethyl)phenol.
| Compound Name | 2,3,4-tris(methylaminomethyl)phenol |
|---|---|
| PubChem CID | 70459249 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2,3,4-tris(methylaminomethyl)phenol |
| SMILES | CNCc1ccc(O)c(CNC)c1CNC |
| InChI | InChI=1S/C12H21N3O/c1-13-6-9-4-5-12(16)11(8-15-3)10(9)7-14-2/h4-5,13-16H,6-8H2,1-3H3 |
| InChIKey | NAEJSJSCIWGABP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|