C17H20N2O4 — CID 70460995
[1-[2-(1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] methyl carbonate (PubChem CID 70460995) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is [1-[2-(1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] methyl carbonate.
| Compound Name | [1-[2-(1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70460995 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [1-[2-(1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1CN(CCc2c[nH]c3ccccc23)CCC1=O |
| InChI | InChI=1S/C17H20N2O4/c1-22-17(21)23-16-11-19(9-7-15(16)20)8-6-12-10-18-14-5-3-2-4-13(12)14/h2-5,10,16,18H,6-9,11H2,1H3 |
| InChIKey | OLRMTKZDGQPLQC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |