C18H22Cl2N2O4 — CID 70460297
[1-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] ethyl carbonate;hydrochloride (PubChem CID 70460297) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is [1-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] ethyl carbonate;hydrochloride.
| Compound Name | [1-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] ethyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 70460297 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [1-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-oxopiperidin-3-yl] ethyl carbonate;hydrochloride |
| SMILES | CCOC(=O)OC1CN(CCc2c[nH]c3ccc(Cl)cc23)CCC1=O.Cl |
| InChI | InChI=1S/C18H21ClN2O4.ClH/c1-2-24-18(23)25-17-11-21(8-6-16(17)22)7-5-12-10-20-15-4-3-13(19)9-14(12)15;/h3-4,9-10,17,20H,2,5-8,11H2,1H3;1H |
| InChIKey | QGYAILZBEWPTEB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |