C20H20N4 — CID 70461127
2-[3-(2,6-diethylphenyl)imidazol-4-yl]-1H-benzimidazole (PubChem CID 70461127) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-[3-(2,6-diethylphenyl)imidazol-4-yl]-1H-benzimidazole.
| Compound Name | 2-[3-(2,6-diethylphenyl)imidazol-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 70461127 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[3-(2,6-diethylphenyl)imidazol-4-yl]-1H-benzimidazole |
| SMILES | CCc1cccc(CC)c1-n1cncc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H20N4/c1-3-14-8-7-9-15(4-2)19(14)24-13-21-12-18(24)20-22-16-10-5-6-11-17(16)23-20/h5-13H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | IHXXIZIELDCITC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |