C26H26N2O4 — CID 70464685
2-[3-(1,3-dioxoisoindol-2-yl)-1,3,5,5-tetramethylcyclohexyl]isoindole-1,3-dione (PubChem CID 70464685) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)-1,3,5,5-tetramethylcyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)-1,3,5,5-tetramethylcyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70464685 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)-1,3,5,5-tetramethylcyclohexyl]isoindole-1,3-dione |
| SMILES | CC1(C)CC(C)(N2C(=O)c3ccccc3C2=O)CC(C)(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C26H26N2O4/c1-24(2)13-25(3,27-20(29)16-9-5-6-10-17(16)21(27)30)15-26(4,14-24)28-22(31)18-11-7-8-12-19(18)23(28)32/h5-12H,13-15H2,1-4H3 |
| InChIKey | TUYHXISDIVAEIO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|