C15H13N3O6S — CID 7046593
methyl 2-[[(4S)-5-cyano-4-(4-hydroxy-3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetate (PubChem CID 7046593) has the molecular formula C15H13N3O6S and a molecular weight of 363.35 g/mol. Its IUPAC name is methyl 2-[[(4S)-5-cyano-4-(4-hydroxy-3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[(4S)-5-cyano-4-(4-hydroxy-3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7046593 |
| Molecular Formula | C15H13N3O6S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | methyl 2-[[(4S)-5-cyano-4-(4-hydroxy-3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSC1=C(C#N)[C@H](c2ccc(O)c([N+](=O)[O-])c2)CC(=O)N1 |
| InChI | InChI=1S/C15H13N3O6S/c1-24-14(21)7-25-15-10(6-16)9(5-13(20)17-15)8-2-3-12(19)11(4-8)18(22)23/h2-4,9,19H,5,7H2,1H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | ZJMGUIKRCCRXQL-VIFPVBQESA-N |
| XLogP | 1.55 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|