C21H27NO9 — CID 70466272
(2R,4R)-5-[(2S)-2-(1-ethoxycarbonyloxyethoxycarbonyloxy)-2,3-dihydroindol-1-yl]-2,4-dimethyl-5-oxopentanoic acid (PubChem CID 70466272) has the molecular formula C21H27NO9 and a molecular weight of 437.45 g/mol. Its IUPAC name is (2R,4R)-5-[(2S)-2-(1-ethoxycarbonyloxyethoxycarbonyloxy)-2,3-dihydroindol-1-yl]-2,4-dimethyl-5-oxopentanoic acid.
| Compound Name | (2R,4R)-5-[(2S)-2-(1-ethoxycarbonyloxyethoxycarbonyloxy)-2,3-dihydroindol-1-yl]-2,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70466272 |
| Molecular Formula | C21H27NO9 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (2R,4R)-5-[(2S)-2-(1-ethoxycarbonyloxyethoxycarbonyloxy)-2,3-dihydroindol-1-yl]-2,4-dimethyl-5-oxopentanoic acid |
| SMILES | CCOC(=O)OC(C)OC(=O)O[C@H]1Cc2ccccc2N1C(=O)[C@H](C)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H27NO9/c1-5-28-20(26)29-14(4)30-21(27)31-17-11-15-8-6-7-9-16(15)22(17)18(23)12(2)10-13(3)19(24)25/h6-9,12-14,17H,5,10-11H2,1-4H3,(H,24,25)/t12-,13-,14?,17+/m1/s1 |
| InChIKey | IEEQQBRXJQCDAR-ONPZOWDYSA-N |
| XLogP | 3.32 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|