C25H42O3 — CID 70466561
(8R,9R,10S,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-1,10,13,16,16-pentamethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70466561) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-1,10,13,16,16-pentamethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-1,10,13,16,16-pentamethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70466561 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-hydroxy-17-(3-hydroxypropyl)-1,10,13,16,16-pentamethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC(=O)CC2CC[C@@H]3[C@@H](CC[C@@]4(C)[C@H]3CC(C)(C)C4(O)CCCO)[C@@]12C |
| InChI | InChI=1S/C25H42O3/c1-16-13-18(27)14-17-7-8-19-20(24(16,17)5)9-11-23(4)21(19)15-22(2,3)25(23,28)10-6-12-26/h16-17,19-21,26,28H,6-15H2,1-5H3/t16?,17?,19-,20-,21+,23+,24+,25?/m1/s1 |
| InChIKey | OOLIURUESFYWRH-ZUXGNJSKSA-N |
| XLogP | 4.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |