C15H23BrO2 — CID 70467158
1-(2-bromo-3,3-dimethoxypropyl)-4-(2-methylpropyl)benzene (PubChem CID 70467158) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-(2-bromo-3,3-dimethoxypropyl)-4-(2-methylpropyl)benzene.
| Compound Name | 1-(2-bromo-3,3-dimethoxypropyl)-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 70467158 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(2-bromo-3,3-dimethoxypropyl)-4-(2-methylpropyl)benzene |
| SMILES | COC(OC)C(Br)Cc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C15H23BrO2/c1-11(2)9-12-5-7-13(8-6-12)10-14(16)15(17-3)18-4/h5-8,11,14-15H,9-10H2,1-4H3 |
| InChIKey | WXCOSEUDNBSTHU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|