C13H10N2O — CID 70467238
4-phenyl-1,3-benzoxazol-2-amine (PubChem CID 70467238) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-phenyl-1,3-benzoxazol-2-amine.
| Compound Name | 4-phenyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 70467238 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-phenyl-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2c(-c3ccccc3)cccc2o1 |
| InChI | InChI=1S/C13H10N2O/c14-13-15-12-10(7-4-8-11(12)16-13)9-5-2-1-3-6-9/h1-8H,(H2,14,15) |
| InChIKey | CYIGXYXLKHPUTF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |