C32H20N2O — CID 175190264
4-[4-[2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]phenyl]benzonitrile (PubChem CID 175190264) has the molecular formula C32H20N2O and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[4-[2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 175190264 |
| Molecular Formula | C32H20N2O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[4-[2-(4-phenylphenyl)-1,3-benzoxazol-4-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3cccc4oc(-c5ccc(-c6ccccc6)cc5)nc34)cc2)cc1 |
| InChI | InChI=1S/C32H20N2O/c33-21-22-9-11-24(12-10-22)26-13-17-27(18-14-26)29-7-4-8-30-31(29)34-32(35-30)28-19-15-25(16-20-28)23-5-2-1-3-6-23/h1-20H |
| InChIKey | BZEQELCOOYSPHT-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |