C18H12N3O+ — CID 7047045
2-amino-4-phenyl-[1]benzofuro[3,2-b]pyridin-1-ium-3-carbonitrile (PubChem CID 7047045) has the molecular formula C18H12N3O+ and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-amino-4-phenyl-[1]benzofuro[3,2-b]pyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-4-phenyl-[1]benzofuro[3,2-b]pyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7047045 |
| Molecular Formula | C18H12N3O+ |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-amino-4-phenyl-[1]benzofuro[3,2-b]pyridin-1-ium-3-carbonitrile |
| SMILES | N#Cc1c(N)[nH+]c2c(oc3ccccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C18H11N3O/c19-10-13-15(11-6-2-1-3-7-11)17-16(21-18(13)20)12-8-4-5-9-14(12)22-17/h1-9H,(H2,20,21)/p+1 |
| InChIKey | UBWHQFNUKBGOMJ-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |