C27H23N3O8 — CID 70473165
methyl 4-[2,6-dimethyl-3,5-bis(pyridin-3-yloxycarbonyloxy)-1,4-dihydropyridin-4-yl]benzoate (PubChem CID 70473165) has the molecular formula C27H23N3O8 and a molecular weight of 517.49 g/mol. Its IUPAC name is methyl 4-[2,6-dimethyl-3,5-bis(pyridin-3-yloxycarbonyloxy)-1,4-dihydropyridin-4-yl]benzoate.
| Compound Name | methyl 4-[2,6-dimethyl-3,5-bis(pyridin-3-yloxycarbonyloxy)-1,4-dihydropyridin-4-yl]benzoate |
|---|---|
| PubChem CID | 70473165 |
| Molecular Formula | C27H23N3O8 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | methyl 4-[2,6-dimethyl-3,5-bis(pyridin-3-yloxycarbonyloxy)-1,4-dihydropyridin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(OC(=O)Oc3cccnc3)=C(C)NC(C)=C2OC(=O)Oc2cccnc2)cc1 |
| InChI | InChI=1S/C27H23N3O8/c1-16-23(37-26(32)35-20-6-4-12-28-14-20)22(18-8-10-19(11-9-18)25(31)34-3)24(17(2)30-16)38-27(33)36-21-7-5-13-29-15-21/h4-15,22,30H,1-3H3 |
| InChIKey | KWAKROFSPDBKFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|