C16H16Cl3N3O — CID 70474089
3-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]pyridine-4-carboxamide (PubChem CID 70474089) has the molecular formula C16H16Cl3N3O and a molecular weight of 372.68 g/mol. Its IUPAC name is 3-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70474089 |
| Molecular Formula | C16H16Cl3N3O |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-[2,2,2-trichloro-1-(2-phenylethylamino)ethyl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccncc1C(NCCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H16Cl3N3O/c17-16(18,19)14(13-10-21-8-7-12(13)15(20)23)22-9-6-11-4-2-1-3-5-11/h1-5,7-8,10,14,22H,6,9H2,(H2,20,23) |
| InChIKey | UGPHZLCXEDFXDU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|