C11H19Cl2N3O2 — CID 142243658
3-[1-(3-hydroxypropylamino)ethyl]pyridine-4-carboxamide;dihydrochloride (PubChem CID 142243658) has the molecular formula C11H19Cl2N3O2 and a molecular weight of 296.20 g/mol. Its IUPAC name is 3-[1-(3-hydroxypropylamino)ethyl]pyridine-4-carboxamide;dihydrochloride.
| Compound Name | 3-[1-(3-hydroxypropylamino)ethyl]pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 142243658 |
| Molecular Formula | C11H19Cl2N3O2 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-[1-(3-hydroxypropylamino)ethyl]pyridine-4-carboxamide;dihydrochloride |
| SMILES | CC(NCCCO)c1cnccc1C(N)=O.Cl.Cl |
| InChI | InChI=1S/C11H17N3O2.2ClH/c1-8(14-4-2-6-15)10-7-13-5-3-9(10)11(12)16;;/h3,5,7-8,14-15H,2,4,6H2,1H3,(H2,12,16);2*1H |
| InChIKey | FWNBJUOBOWQHJE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|