C12H20N2O — CID 81410455
5-[[(1S)-1-pyridin-4-ylethyl]amino]pentan-1-ol (PubChem CID 81410455) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 5-[[(1S)-1-pyridin-4-ylethyl]amino]pentan-1-ol.
| Compound Name | 5-[[(1S)-1-pyridin-4-ylethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 81410455 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-[[(1S)-1-pyridin-4-ylethyl]amino]pentan-1-ol |
| SMILES | C[C@H](NCCCCCO)c1ccncc1 |
| InChI | InChI=1S/C12H20N2O/c1-11(12-5-8-13-9-6-12)14-7-3-2-4-10-15/h5-6,8-9,11,14-15H,2-4,7,10H2,1H3/t11-/m0/s1 |
| InChIKey | GJCAUOKSWWBSIU-NSHDSACASA-N |
| XLogP | 1.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|