C12H20N2S — CID 103088256
4-methylsulfanyl-N-[(1S)-1-pyridin-4-ylethyl]butan-1-amine (PubChem CID 103088256) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[(1S)-1-pyridin-4-ylethyl]butan-1-amine.
| Compound Name | 4-methylsulfanyl-N-[(1S)-1-pyridin-4-ylethyl]butan-1-amine |
|---|---|
| PubChem CID | 103088256 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-methylsulfanyl-N-[(1S)-1-pyridin-4-ylethyl]butan-1-amine |
| SMILES | CSCCCCN[C@@H](C)c1ccncc1 |
| InChI | InChI=1S/C12H20N2S/c1-11(12-5-8-13-9-6-12)14-7-3-4-10-15-2/h5-6,8-9,11,14H,3-4,7,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | KFBLNYSLNSRJPC-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|