C15H25NO2S2 — CID 104926336
5-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]pentan-1-amine (PubChem CID 104926336) has the molecular formula C15H25NO2S2 and a molecular weight of 315.50 g/mol. Its IUPAC name is 5-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]pentan-1-amine.
| Compound Name | 5-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 104926336 |
| Molecular Formula | C15H25NO2S2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]pentan-1-amine |
| SMILES | CSCCCCCNC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H25NO2S2/c1-13(16-11-5-4-6-12-19-2)14-7-9-15(10-8-14)20(3,17)18/h7-10,13,16H,4-6,11-12H2,1-3H3 |
| InChIKey | SLRQUBMRQSFGTD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|