C15H25N3OS — CID 104926294
[4-[1-(5-methylsulfanylpentylamino)ethyl]phenyl]urea (PubChem CID 104926294) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is [4-[1-(5-methylsulfanylpentylamino)ethyl]phenyl]urea.
| Compound Name | [4-[1-(5-methylsulfanylpentylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 104926294 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [4-[1-(5-methylsulfanylpentylamino)ethyl]phenyl]urea |
| SMILES | CSCCCCCNC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H25N3OS/c1-12(17-10-4-3-5-11-20-2)13-6-8-14(9-7-13)18-15(16)19/h6-9,12,17H,3-5,10-11H2,1-2H3,(H3,16,18,19) |
| InChIKey | SMAFDOFPZXYVPV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|