C24H23NO — CID 7047438
1-[(4S)-2,4-diphenyl-4H-chromen-3-yl]-N,N-dimethylmethanamine (PubChem CID 7047438) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[(4S)-2,4-diphenyl-4H-chromen-3-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(4S)-2,4-diphenyl-4H-chromen-3-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 7047438 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-[(4S)-2,4-diphenyl-4H-chromen-3-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1=C(c2ccccc2)Oc2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H23NO/c1-25(2)17-21-23(18-11-5-3-6-12-18)20-15-9-10-16-22(20)26-24(21)19-13-7-4-8-14-19/h3-16,23H,17H2,1-2H3/t23-/m0/s1 |
| InChIKey | SLTVLNJKFKLCRM-QHCPKHFHSA-N |
| XLogP | 5.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |