About 2-methylpropane;9-phenyl-9H-xanthene
2-methylpropane;9-phenyl-9H-xanthene (PubChem CID 158880886) has the molecular formula C23H24O
and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-methylpropane;9-phenyl-9H-xanthene.
Molecular Properties
| Compound Name | 2-methylpropane;9-phenyl-9H-xanthene |
| PubChem CID | 158880886 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-methylpropane;9-phenyl-9H-xanthene |
| SMILES | CC(C)C.c1ccc(C2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C19H14O.C4H10/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19;1-4(2)3/h1-13,19H;4H,1-3H3 |
| InChIKey | JDABMJUFDZMJEB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropane;9-phenyl-9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;9-phenyl-9H-xanthene?
The IUPAC name of 2-methylpropane;9-phenyl-9H-xanthene (CID 158880886) is 2-methylpropane;9-phenyl-9H-xanthene.
What is the SMILES notation for 2-methylpropane;9-phenyl-9H-xanthene?
The canonical SMILES for 2-methylpropane;9-phenyl-9H-xanthene is CC(C)C.c1ccc(C2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of 2-methylpropane;9-phenyl-9H-xanthene?
The InChIKey is JDABMJUFDZMJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O.C4H10/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19;1-4(2)3/h1-13,19H;4H,1-3H3.
What are the key properties of 2-methylpropane;9-phenyl-9H-xanthene?
2-methylpropane;9-phenyl-9H-xanthene has a molecular weight of 316.44 g/mol, XLogP of 6.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;9-phenyl-9H-xanthene is sourced from PubChem (CID 158880886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).