About methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate
methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate (PubChem CID 70474906) has the molecular formula C15H20O6S
and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate.
Molecular Properties
| Compound Name | methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate |
| PubChem CID | 70474906 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate |
| SMILES | COC(=O)C(c1ccc(C2COC(C)(C)O2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H20O6S/c1-15(2)20-9-12(21-15)10-5-7-11(8-6-10)13(14(16)19-3)22(4,17)18/h5-8,12-13H,9H2,1-4H3 |
| InChIKey | WEGBUVBAWOOYKO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate?
The IUPAC name of methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate (CID 70474906) is methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate.
What is the SMILES notation for methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate?
The canonical SMILES for methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate is COC(=O)C(c1ccc(C2COC(C)(C)O2)cc1)S(C)(=O)=O.
What is the InChIKey of methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate?
The InChIKey is WEGBUVBAWOOYKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O6S/c1-15(2)20-9-12(21-15)10-5-7-11(8-6-10)13(14(16)19-3)22(4,17)18/h5-8,12-13H,9H2,1-4H3.
What are the key properties of methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate?
methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate has a molecular weight of 328.39 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)phenyl]-2-methylsulfonylacetate is sourced from PubChem (CID 70474906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).