C21H23N3O3 — CID 70476238
pyridin-3-yl 3-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]propanoate (PubChem CID 70476238) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is pyridin-3-yl 3-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]propanoate.
| Compound Name | pyridin-3-yl 3-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 70476238 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | pyridin-3-yl 3-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]propanoate |
| SMILES | O=C(CCN1CCN(C(=O)C=Cc2ccccc2)CC1)Oc1cccnc1 |
| InChI | InChI=1S/C21H23N3O3/c25-20(9-8-18-5-2-1-3-6-18)24-15-13-23(14-16-24)12-10-21(26)27-19-7-4-11-22-17-19/h1-9,11,17H,10,12-16H2 |
| InChIKey | VJCMBSDAPYIHJL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|