C20H30N4O — CID 56805294
(E)-1-[4-(1-propylpiperidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 56805294) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is (E)-1-[4-(1-propylpiperidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(1-propylpiperidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 56805294 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (E)-1-[4-(1-propylpiperidin-4-yl)piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | CCCN1CCC(N2CCN(C(=O)/C=C/c3cccnc3)CC2)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-2-10-22-11-7-19(8-12-22)23-13-15-24(16-14-23)20(25)6-5-18-4-3-9-21-17-18/h3-6,9,17,19H,2,7-8,10-16H2,1H3/b6-5+ |
| InChIKey | IZMCEGPLXBMRKJ-AATRIKPKSA-N |
| XLogP | 2.11 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|