C23H29FO2 — CID 70478674
(7R,8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-17-hydroxy-7,13-dimethyl-17-prop-1-ynyl-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70478674) has the molecular formula C23H29FO2 and a molecular weight of 356.48 g/mol. Its IUPAC name is (7R,8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-17-hydroxy-7,13-dimethyl-17-prop-1-ynyl-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-17-hydroxy-7,13-dimethyl-17-prop-1-ynyl-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70478674 |
| Molecular Formula | C23H29FO2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (7R,8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-17-hydroxy-7,13-dimethyl-17-prop-1-ynyl-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@H]3[C@H](/C(=C/F)C[C@@]21C)[C@H]1CCC(=O)C=C1C[C@H]3C |
| InChI | InChI=1S/C23H29FO2/c1-4-8-23(26)9-7-19-20-14(2)10-15-11-17(25)5-6-18(15)21(20)16(13-24)12-22(19,23)3/h11,13-14,18-21,26H,5-7,9-10,12H2,1-3H3/b16-13+/t14-,18+,19+,20+,21-,22+,23+/m1/s1 |
| InChIKey | ORCODYUXLMLCIH-IFHLCMOQSA-N |
| XLogP | 4.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|