C22H29FO — CID 70478112
(8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-13-methyl-17-prop-1-ynyl-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 70478112) has the molecular formula C22H29FO and a molecular weight of 328.47 g/mol. Its IUPAC name is (8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-13-methyl-17-prop-1-ynyl-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-13-methyl-17-prop-1-ynyl-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70478112 |
| Molecular Formula | C22H29FO |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (8S,9S,10R,11E,13S,14S,17S)-11-(fluoromethylidene)-13-methyl-17-prop-1-ynyl-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CCCC[C@@H]4[C@H]3/C(=C/F)C[C@@]21C |
| InChI | InChI=1S/C22H29FO/c1-3-11-22(24)12-10-19-18-9-8-15-6-4-5-7-17(15)20(18)16(14-23)13-21(19,22)2/h6,14,17-20,24H,4-5,7-10,12-13H2,1-2H3/b16-14+/t17-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | KGKOHHMCQDHUBA-BYBFHVTISA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|