C25H44O — CID 142858892
ethane;(9S,14S,17S)-13-ethyl-17-methyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 142858892) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is ethane;(9S,14S,17S)-13-ethyl-17-methyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | ethane;(9S,14S,17S)-13-ethyl-17-methyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 142858892 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | ethane;(9S,14S,17S)-13-ethyl-17-methyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C=C1CC2(CC)[C@@H](CC[C@]2(C)O)C2CCC3=CCCCC3[C@@H]12.CC.CC |
| InChI | InChI=1S/C21H32O.2C2H6/c1-4-21-13-14(2)19-16-8-6-5-7-15(16)9-10-17(19)18(21)11-12-20(21,3)22;2*1-2/h7,16-19,22H,2,4-6,8-13H2,1,3H3;2*1-2H3/t16?,17?,18-,19+,20-,21?;;/m0../s1 |
| InChIKey | NDHKHBLHWRHJHH-UBWBIGRESA-N |
| XLogP | 7.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|