C24H34O4 — CID 138501809
CID 138501809 (PubChem CID 138501809) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol.
| Compound Name | CID 138501809 |
|---|---|
| PubChem CID | 138501809 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | — |
| SMILES | C=C1C[C@@]2(CC)C(CCC23OCCO3)C2CCC3=CC4(CCC3C12)OCCO4 |
| InChI | InChI=1S/C24H34O4/c1-3-22-14-16(2)21-18-6-8-23(25-10-11-26-23)15-17(18)4-5-19(21)20(22)7-9-24(22)27-12-13-28-24/h15,18-21H,2-14H2,1H3/t18?,19?,20?,21?,22-/m0/s1 |
| InChIKey | JKCMBEGUOXCRBP-BLJKDTPWSA-N |
| XLogP | 4.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|