C22H30O2 — CID 171380807
(8S,9S,10R,13S,14S,17S)-13-ethyl-3-ethynyl-11-methylidene-1,2,6,7,8,9,10,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 171380807) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-13-ethyl-3-ethynyl-11-methylidene-1,2,6,7,8,9,10,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,10R,13S,14S,17S)-13-ethyl-3-ethynyl-11-methylidene-1,2,6,7,8,9,10,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 171380807 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-13-ethyl-3-ethynyl-11-methylidene-1,2,6,7,8,9,10,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C#CC1(O)C=C2CC[C@@H]3[C@H](C(=C)C[C@]4(CC)[C@@H](O)CC[C@@H]34)[C@H]2CC1 |
| InChI | InChI=1S/C22H30O2/c1-4-21(24)11-10-16-15(13-21)6-7-17-18-8-9-19(23)22(18,5-2)12-14(3)20(16)17/h1,13,16-20,23-24H,3,5-12H2,2H3/t16-,17-,18-,19-,20+,21?,22-/m0/s1 |
| InChIKey | NXYFKRJIOGDMHW-STBKVDIISA-N |
| XLogP | 3.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|