C24H29ClO3 — CID 70563070
[(8S,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-13-ethyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70563070) has the molecular formula C24H29ClO3 and a molecular weight of 400.95 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-13-ethyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-13-ethyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70563070 |
| Molecular Formula | C24H29ClO3 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17S)-17-(2-chloroethynyl)-13-ethyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C1C[C@@]2(CC)[C@@H](CC[C@]2(C#CCl)OC(C)=O)[C@@H]2CCC3=CC(=O)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C24H29ClO3/c1-4-23-14-15(2)22-19-8-6-18(27)13-17(19)5-7-20(22)21(23)9-10-24(23,11-12-25)28-16(3)26/h13,19-22H,2,4-10,14H2,1,3H3/t19-,20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | PRXMJALAQMEQOA-FMWSTDPOSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|