C22H32O2 — CID 90869966
13-ethyl-17-hydroxy-10,17-dimethyl-11-methylidene-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 90869966) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 13-ethyl-17-hydroxy-10,17-dimethyl-11-methylidene-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 13-ethyl-17-hydroxy-10,17-dimethyl-11-methylidene-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90869966 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 13-ethyl-17-hydroxy-10,17-dimethyl-11-methylidene-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1CC2(CC)C(CCC2(C)O)C2CCC3=CC(=O)CCC3(C)C12 |
| InChI | InChI=1S/C22H32O2/c1-5-22-13-14(2)19-17(18(22)9-11-21(22,4)24)7-6-15-12-16(23)8-10-20(15,19)3/h12,17-19,24H,2,5-11,13H2,1,3-4H3 |
| InChIKey | CDORKJWOTLYSIN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|