C21H30ClIO2 — CID 67899072
(8S,9R,10R,11S,13R,14S,17S)-11-(chloromethyl)-17-hydroxy-13-(iodomethyl)-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 67899072) has the molecular formula C21H30ClIO2 and a molecular weight of 476.83 g/mol. Its IUPAC name is (8S,9R,10R,11S,13R,14S,17S)-11-(chloromethyl)-17-hydroxy-13-(iodomethyl)-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,11S,13R,14S,17S)-11-(chloromethyl)-17-hydroxy-13-(iodomethyl)-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67899072 |
| Molecular Formula | C21H30ClIO2 |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (8S,9R,10R,11S,13R,14S,17S)-11-(chloromethyl)-17-hydroxy-13-(iodomethyl)-10,17-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](CCl)C[C@@]2(CI)[C@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C21H30ClIO2/c1-19-7-5-15(24)9-14(19)3-4-16-17-6-8-20(2,25)21(17,12-23)10-13(11-22)18(16)19/h9,13,16-18,25H,3-8,10-12H2,1-2H3/t13-,16+,17+,18+,19+,20+,21-/m1/s1 |
| InChIKey | KBMSKPQTTPUYNE-GWXLLEQUSA-N |
| XLogP | 5.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|