C18H26F2 — CID 154182388
(8R,9S,10R,13S,14S)-17,17-difluoro-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 154182388) has the molecular formula C18H26F2 and a molecular weight of 280.40 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17,17-difluoro-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13S,14S)-17,17-difluoro-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154182388 |
| Molecular Formula | C18H26F2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17,17-difluoro-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CCCC[C@@H]43)[C@@H]1CCC2(F)F |
| InChI | InChI=1S/C18H26F2/c1-17-10-8-14-13-5-3-2-4-12(13)6-7-15(14)16(17)9-11-18(17,19)20/h4,13-16H,2-3,5-11H2,1H3/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | NARJFGBWEQHYDA-BIVLZKPYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|