C30H58O9 — CID 70482183
(2R,3R,4S,5R)-2-[11-ethyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]octadecyl]oxane-2,3,4,5-tetrol (PubChem CID 70482183) has the molecular formula C30H58O9 and a molecular weight of 562.79 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[11-ethyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]octadecyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5R)-2-[11-ethyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]octadecyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 70482183 |
| Molecular Formula | C30H58O9 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | (2R,3R,4S,5R)-2-[11-ethyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]octadecyl]oxane-2,3,4,5-tetrol |
| SMILES | CCCCCCCC(CC)CCCCCCCC(CC[C@@]1(O)OC[C@@H](O)[C@H](O)[C@H]1O)[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H58O9/c1-3-5-6-8-11-14-21(4-2)15-12-9-7-10-13-16-22(28-27(35)25(33)23(31)19-38-28)17-18-30(37)29(36)26(34)24(32)20-39-30/h21-29,31-37H,3-20H2,1-2H3/t21?,22?,23-,24-,25+,26+,27-,28+,29-,30-/m1/s1 |
| InChIKey | UQBJEAQMERXSEG-HEBHYERPSA-N |
| XLogP | 2.78 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|