C20H32N4O3S — CID 70482857
ethyl 3-(2-methyl-3-octoxypyrazolo[4,3-d]pyrimidin-7-yl)sulfanylbutanoate (PubChem CID 70482857) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is ethyl 3-(2-methyl-3-octoxypyrazolo[4,3-d]pyrimidin-7-yl)sulfanylbutanoate.
| Compound Name | ethyl 3-(2-methyl-3-octoxypyrazolo[4,3-d]pyrimidin-7-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 70482857 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | ethyl 3-(2-methyl-3-octoxypyrazolo[4,3-d]pyrimidin-7-yl)sulfanylbutanoate |
| SMILES | CCCCCCCCOc1c2ncnc(SC(C)CC(=O)OCC)c2nn1C |
| InChI | InChI=1S/C20H32N4O3S/c1-5-7-8-9-10-11-12-27-20-18-17(23-24(20)4)19(22-14-21-18)28-15(3)13-16(25)26-6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | SFWQRULYRZYDHY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|